C18H12Cl2FNO4 — CID 55324913
(4-fluorophenyl)methyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 55324913) has the molecular formula C18H12Cl2FNO4 and a molecular weight of 396.20 g/mol. Its IUPAC name is (4-fluorophenyl)methyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | (4-fluorophenyl)methyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 55324913 |
| Molecular Formula | C18H12Cl2FNO4 |
| Molecular Weight | 396.20 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | (4-fluorophenyl)methyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CC(C(=O)OCc1ccc(F)cc1)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C18H12Cl2FNO4/c1-9(18(25)26-8-10-2-4-11(21)5-3-10)22-16(23)12-6-14(19)15(20)7-13(12)17(22)24/h2-7,9H,8H2,1H3 |
| InChIKey | UWAXYHHTSBMVMF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.20 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|