C18H14FNO4 — CID 3559613
(4-fluorophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 3559613) has the molecular formula C18H14FNO4 and a molecular weight of 327.31 g/mol. Its IUPAC name is (4-fluorophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | (4-fluorophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 3559613 |
| Molecular Formula | C18H14FNO4 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (4-fluorophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CC(C(=O)OCc1ccc(F)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H14FNO4/c1-11(18(23)24-10-12-6-8-13(19)9-7-12)20-16(21)14-4-2-3-5-15(14)17(20)22/h2-9,11H,10H2,1H3 |
| InChIKey | HMCYVGLNUXANOS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|