C23H25Cl2N3O3 — CID 22175586
3-[3-(aminomethyl)-4-butoxy-6,7-dichloro-1-oxoisoquinolin-2-yl]-N-phenylpropanamide (PubChem CID 22175586) has the molecular formula C23H25Cl2N3O3 and a molecular weight of 462.38 g/mol. Its IUPAC name is 3-[3-(aminomethyl)-4-butoxy-6,7-dichloro-1-oxoisoquinolin-2-yl]-N-phenylpropanamide.
| Compound Name | 3-[3-(aminomethyl)-4-butoxy-6,7-dichloro-1-oxoisoquinolin-2-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 22175586 |
| Molecular Formula | C23H25Cl2N3O3 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 3-[3-(aminomethyl)-4-butoxy-6,7-dichloro-1-oxoisoquinolin-2-yl]-N-phenylpropanamide |
| SMILES | CCCCOc1c(CN)n(CCC(=O)Nc2ccccc2)c(=O)c2cc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C23H25Cl2N3O3/c1-2-3-11-31-22-16-12-18(24)19(25)13-17(16)23(30)28(20(22)14-26)10-9-21(29)27-15-7-5-4-6-8-15/h4-8,12-13H,2-3,9-11,14,26H2,1H3,(H,27,29) |
| InChIKey | KPAAYUQPUMYHRN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|