C24H25Cl2N3O5 — CID 87799182
[2-(2-anilino-3-oxopropyl)-4-butoxy-6,7-dichloro-1-oxoisoquinolin-3-yl]-methylcarbamic acid (PubChem CID 87799182) has the molecular formula C24H25Cl2N3O5 and a molecular weight of 506.39 g/mol. Its IUPAC name is [2-(2-anilino-3-oxopropyl)-4-butoxy-6,7-dichloro-1-oxoisoquinolin-3-yl]-methylcarbamic acid.
| Compound Name | [2-(2-anilino-3-oxopropyl)-4-butoxy-6,7-dichloro-1-oxoisoquinolin-3-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 87799182 |
| Molecular Formula | C24H25Cl2N3O5 |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | [2-(2-anilino-3-oxopropyl)-4-butoxy-6,7-dichloro-1-oxoisoquinolin-3-yl]-methylcarbamic acid |
| SMILES | CCCCOc1c(N(C)C(=O)O)n(CC(C=O)Nc2ccccc2)c(=O)c2cc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C24H25Cl2N3O5/c1-3-4-10-34-21-17-11-19(25)20(26)12-18(17)23(31)29(22(21)28(2)24(32)33)13-16(14-30)27-15-8-6-5-7-9-15/h5-9,11-12,14,16,27H,3-4,10,13H2,1-2H3,(H,32,33) |
| InChIKey | BSQOQCGZNHMHTD-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|