C27H34N2O5 — CID 69366742
[4-butoxy-2-(2,2-dimethylpropyl)-1-oxo-6-phenylmethoxyisoquinolin-3-yl]-methylcarbamic acid (PubChem CID 69366742) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is [4-butoxy-2-(2,2-dimethylpropyl)-1-oxo-6-phenylmethoxyisoquinolin-3-yl]-methylcarbamic acid.
| Compound Name | [4-butoxy-2-(2,2-dimethylpropyl)-1-oxo-6-phenylmethoxyisoquinolin-3-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 69366742 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | [4-butoxy-2-(2,2-dimethylpropyl)-1-oxo-6-phenylmethoxyisoquinolin-3-yl]-methylcarbamic acid |
| SMILES | CCCCOc1c(N(C)C(=O)O)n(CC(C)(C)C)c(=O)c2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C27H34N2O5/c1-6-7-15-33-23-22-16-20(34-17-19-11-9-8-10-12-19)13-14-21(22)25(30)29(18-27(2,3)4)24(23)28(5)26(31)32/h8-14,16H,6-7,15,17-18H2,1-5H3,(H,31,32) |
| InChIKey | YPCKGHOCYFBPNE-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|