C23H34N2O5 — CID 91492194
tert-butyl N-[2-(2,2-dimethylpropyl)-4-(2-methoxyethoxy)-1-oxoisoquinolin-3-yl]-N-methylcarbamate (PubChem CID 91492194) has the molecular formula C23H34N2O5 and a molecular weight of 418.53 g/mol. Its IUPAC name is tert-butyl N-[2-(2,2-dimethylpropyl)-4-(2-methoxyethoxy)-1-oxoisoquinolin-3-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-(2,2-dimethylpropyl)-4-(2-methoxyethoxy)-1-oxoisoquinolin-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 91492194 |
| Molecular Formula | C23H34N2O5 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | tert-butyl N-[2-(2,2-dimethylpropyl)-4-(2-methoxyethoxy)-1-oxoisoquinolin-3-yl]-N-methylcarbamate |
| SMILES | COCCOc1c(N(C)C(=O)OC(C)(C)C)n(CC(C)(C)C)c(=O)c2ccccc12 |
| InChI | InChI=1S/C23H34N2O5/c1-22(2,3)15-25-19(24(7)21(27)30-23(4,5)6)18(29-14-13-28-8)16-11-9-10-12-17(16)20(25)26/h9-12H,13-15H2,1-8H3 |
| InChIKey | ZDQFUPJSKZSYNU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|