C26H36Cl2N2O8 — CID 162175448
tert-butyl 6,7-dichloro-4-[3-(dimethylamino)propoxy]-2-(2,2-dimethylpropyl)-1-oxoisoquinoline-3-carboxylate;oxalic acid (PubChem CID 162175448) has the molecular formula C26H36Cl2N2O8 and a molecular weight of 575.49 g/mol. Its IUPAC name is tert-butyl 6,7-dichloro-4-[3-(dimethylamino)propoxy]-2-(2,2-dimethylpropyl)-1-oxoisoquinoline-3-carboxylate;oxalic acid.
| Compound Name | tert-butyl 6,7-dichloro-4-[3-(dimethylamino)propoxy]-2-(2,2-dimethylpropyl)-1-oxoisoquinoline-3-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 162175448 |
| Molecular Formula | C26H36Cl2N2O8 |
| Molecular Weight | 575.49 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | tert-butyl 6,7-dichloro-4-[3-(dimethylamino)propoxy]-2-(2,2-dimethylpropyl)-1-oxoisoquinoline-3-carboxylate;oxalic acid |
| SMILES | CN(C)CCCOc1c(C(=O)OC(C)(C)C)n(CC(C)(C)C)c(=O)c2cc(Cl)c(Cl)cc12.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H34Cl2N2O4.C2H2O4/c1-23(2,3)14-28-19(22(30)32-24(4,5)6)20(31-11-9-10-27(7)8)15-12-17(25)18(26)13-16(15)21(28)29;3-1(4)2(5)6/h12-13H,9-11,14H2,1-8H3;(H,3,4)(H,5,6) |
| InChIKey | ZOIJISNMQJPCAD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|