C24H36N2O5 — CID 86592068
tert-butyl N-[[4-butoxy-2-(2,2-dimethylpropyl)-6-hydroxy-1-oxoisoquinolin-3-yl]methyl]carbamate (PubChem CID 86592068) has the molecular formula C24H36N2O5 and a molecular weight of 432.56 g/mol. Its IUPAC name is tert-butyl N-[[4-butoxy-2-(2,2-dimethylpropyl)-6-hydroxy-1-oxoisoquinolin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-butoxy-2-(2,2-dimethylpropyl)-6-hydroxy-1-oxoisoquinolin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 86592068 |
| Molecular Formula | C24H36N2O5 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | tert-butyl N-[[4-butoxy-2-(2,2-dimethylpropyl)-6-hydroxy-1-oxoisoquinolin-3-yl]methyl]carbamate |
| SMILES | CCCCOc1c(CNC(=O)OC(C)(C)C)n(CC(C)(C)C)c(=O)c2ccc(O)cc12 |
| InChI | InChI=1S/C24H36N2O5/c1-8-9-12-30-20-18-13-16(27)10-11-17(18)21(28)26(15-23(2,3)4)19(20)14-25-22(29)31-24(5,6)7/h10-11,13,27H,8-9,12,14-15H2,1-7H3,(H,25,29) |
| InChIKey | WNOJEFKIKKAXQL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|