C21H28N2O5 — CID 87799509
[4-butoxy-2-(2,2-dimethylpropyl)-6-formyl-1-oxoisoquinolin-3-yl]-methylcarbamic acid (PubChem CID 87799509) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is [4-butoxy-2-(2,2-dimethylpropyl)-6-formyl-1-oxoisoquinolin-3-yl]-methylcarbamic acid.
| Compound Name | [4-butoxy-2-(2,2-dimethylpropyl)-6-formyl-1-oxoisoquinolin-3-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 87799509 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | [4-butoxy-2-(2,2-dimethylpropyl)-6-formyl-1-oxoisoquinolin-3-yl]-methylcarbamic acid |
| SMILES | CCCCOc1c(N(C)C(=O)O)n(CC(C)(C)C)c(=O)c2ccc(C=O)cc12 |
| InChI | InChI=1S/C21H28N2O5/c1-6-7-10-28-17-16-11-14(12-24)8-9-15(16)19(25)23(13-21(2,3)4)18(17)22(5)20(26)27/h8-9,11-12H,6-7,10,13H2,1-5H3,(H,26,27) |
| InChIKey | JEMLGVQKSMQKJE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|