C26H19ClN2O4 — CID 22175270
2-[[6-chloro-4-(4-methoxyphenyl)-2-methyl-1-oxoisoquinolin-3-yl]methyl]isoindole-1,3-dione (PubChem CID 22175270) has the molecular formula C26H19ClN2O4 and a molecular weight of 458.90 g/mol. Its IUPAC name is 2-[[6-chloro-4-(4-methoxyphenyl)-2-methyl-1-oxoisoquinolin-3-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[6-chloro-4-(4-methoxyphenyl)-2-methyl-1-oxoisoquinolin-3-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 22175270 |
| Molecular Formula | C26H19ClN2O4 |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 2-[[6-chloro-4-(4-methoxyphenyl)-2-methyl-1-oxoisoquinolin-3-yl]methyl]isoindole-1,3-dione |
| SMILES | COc1ccc(-c2c(CN3C(=O)c4ccccc4C3=O)n(C)c(=O)c3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C26H19ClN2O4/c1-28-22(14-29-25(31)18-5-3-4-6-19(18)26(29)32)23(15-7-10-17(33-2)11-8-15)21-13-16(27)9-12-20(21)24(28)30/h3-13H,14H2,1-2H3 |
| InChIKey | ZZAGDCZSARBMJP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|