C27H25NO4 — CID 142908173
methyl 2-benzyl-6-methyl-1-oxo-4-(2-phenylethoxy)isoquinoline-3-carboxylate (PubChem CID 142908173) has the molecular formula C27H25NO4 and a molecular weight of 427.50 g/mol. Its IUPAC name is methyl 2-benzyl-6-methyl-1-oxo-4-(2-phenylethoxy)isoquinoline-3-carboxylate.
| Compound Name | methyl 2-benzyl-6-methyl-1-oxo-4-(2-phenylethoxy)isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 142908173 |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | methyl 2-benzyl-6-methyl-1-oxo-4-(2-phenylethoxy)isoquinoline-3-carboxylate |
| SMILES | COC(=O)c1c(OCCc2ccccc2)c2cc(C)ccc2c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C27H25NO4/c1-19-13-14-22-23(17-19)25(32-16-15-20-9-5-3-6-10-20)24(27(30)31-2)28(26(22)29)18-21-11-7-4-8-12-21/h3-14,17H,15-16,18H2,1-2H3 |
| InChIKey | YHGNSWYKFDHMKO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |