C16H24ClNO3 — CID 89451863
tert-butyl N-(4-butoxy-2-chlorophenyl)-N-methylcarbamate (PubChem CID 89451863) has the molecular formula C16H24ClNO3 and a molecular weight of 313.82 g/mol. Its IUPAC name is tert-butyl N-(4-butoxy-2-chlorophenyl)-N-methylcarbamate.
| Compound Name | tert-butyl N-(4-butoxy-2-chlorophenyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 89451863 |
| Molecular Formula | C16H24ClNO3 |
| Molecular Weight | 313.82 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | tert-butyl N-(4-butoxy-2-chlorophenyl)-N-methylcarbamate |
| SMILES | CCCCOc1ccc(N(C)C(=O)OC(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C16H24ClNO3/c1-6-7-10-20-12-8-9-14(13(17)11-12)18(5)15(19)21-16(2,3)4/h8-9,11H,6-7,10H2,1-5H3 |
| InChIKey | HYBAYTSWGOWNGW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.82 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|