C24H19ClF2N2O3 — CID 52919414
2-[5-chloro-3-[[1-[(2,3-difluorophenyl)methyl]-6-oxo-3-pyridinyl]methyl]-2-methylindol-1-yl]acetic acid (PubChem CID 52919414) has the molecular formula C24H19ClF2N2O3 and a molecular weight of 456.88 g/mol. Its IUPAC name is 2-[5-chloro-3-[[1-[(2,3-difluorophenyl)methyl]-6-oxo-3-pyridinyl]methyl]-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[5-chloro-3-[[1-[(2,3-difluorophenyl)methyl]-6-oxo-3-pyridinyl]methyl]-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 52919414 |
| Molecular Formula | C24H19ClF2N2O3 |
| Molecular Weight | 456.88 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 2-[5-chloro-3-[[1-[(2,3-difluorophenyl)methyl]-6-oxo-3-pyridinyl]methyl]-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1c(Cc2ccc(=O)n(Cc3cccc(F)c3F)c2)c2cc(Cl)ccc2n1CC(=O)O |
| InChI | InChI=1S/C24H19ClF2N2O3/c1-14-18(19-10-17(25)6-7-21(19)29(14)13-23(31)32)9-15-5-8-22(30)28(11-15)12-16-3-2-4-20(26)24(16)27/h2-8,10-11H,9,12-13H2,1H3,(H,31,32) |
| InChIKey | ZGTSDIXTMVJARN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.88 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|