C26H17ClF3N3O3 — CID 52919793
2-[5-chloro-2-methyl-3-[4-oxo-3-[(2,4,5-trifluorophenyl)methyl]phthalazin-1-yl]indol-1-yl]acetic acid (PubChem CID 52919793) has the molecular formula C26H17ClF3N3O3 and a molecular weight of 511.89 g/mol. Its IUPAC name is 2-[5-chloro-2-methyl-3-[4-oxo-3-[(2,4,5-trifluorophenyl)methyl]phthalazin-1-yl]indol-1-yl]acetic acid.
| Compound Name | 2-[5-chloro-2-methyl-3-[4-oxo-3-[(2,4,5-trifluorophenyl)methyl]phthalazin-1-yl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 52919793 |
| Molecular Formula | C26H17ClF3N3O3 |
| Molecular Weight | 511.89 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | 2-[5-chloro-2-methyl-3-[4-oxo-3-[(2,4,5-trifluorophenyl)methyl]phthalazin-1-yl]indol-1-yl]acetic acid |
| SMILES | Cc1c(-c2nn(Cc3cc(F)c(F)cc3F)c(=O)c3ccccc23)c2cc(Cl)ccc2n1CC(=O)O |
| InChI | InChI=1S/C26H17ClF3N3O3/c1-13-24(18-9-15(27)6-7-22(18)32(13)12-23(34)35)25-16-4-2-3-5-17(16)26(36)33(31-25)11-14-8-20(29)21(30)10-19(14)28/h2-10H,11-12H2,1H3,(H,34,35) |
| InChIKey | DEBNCAZDKFSVGA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.89 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|