C19H14ClN3O3 — CID 67151302
2-[5-chloro-2-methyl-3-(4-oxo-3H-phthalazin-1-yl)indol-1-yl]acetic acid (PubChem CID 67151302) has the molecular formula C19H14ClN3O3 and a molecular weight of 367.79 g/mol. Its IUPAC name is 2-[5-chloro-2-methyl-3-(4-oxo-3H-phthalazin-1-yl)indol-1-yl]acetic acid.
| Compound Name | 2-[5-chloro-2-methyl-3-(4-oxo-3H-phthalazin-1-yl)indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 67151302 |
| Molecular Formula | C19H14ClN3O3 |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 2-[5-chloro-2-methyl-3-(4-oxo-3H-phthalazin-1-yl)indol-1-yl]acetic acid |
| SMILES | Cc1c(-c2n[nH]c(=O)c3ccccc23)c2cc(Cl)ccc2n1CC(=O)O |
| InChI | InChI=1S/C19H14ClN3O3/c1-10-17(18-12-4-2-3-5-13(12)19(26)22-21-18)14-8-11(20)6-7-15(14)23(10)9-16(24)25/h2-8H,9H2,1H3,(H,22,26)(H,24,25) |
| InChIKey | PTYGJCFDIYKJNY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |