C23H23FN2O2 — CID 143286248
ethyl 2-[3-(2,3-dihydroquinolin-2-ylmethyl)-5-fluoro-2-methylindol-1-yl]acetate (PubChem CID 143286248) has the molecular formula C23H23FN2O2 and a molecular weight of 378.45 g/mol. Its IUPAC name is ethyl 2-[3-(2,3-dihydroquinolin-2-ylmethyl)-5-fluoro-2-methylindol-1-yl]acetate.
| Compound Name | ethyl 2-[3-(2,3-dihydroquinolin-2-ylmethyl)-5-fluoro-2-methylindol-1-yl]acetate |
|---|---|
| PubChem CID | 143286248 |
| Molecular Formula | C23H23FN2O2 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | ethyl 2-[3-(2,3-dihydroquinolin-2-ylmethyl)-5-fluoro-2-methylindol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(C)c(CC2CC=c3ccccc3=N2)c2cc(F)ccc21 |
| InChI | InChI=1S/C23H23FN2O2/c1-3-28-23(27)14-26-15(2)19(20-12-17(24)9-11-22(20)26)13-18-10-8-16-6-4-5-7-21(16)25-18/h4-9,11-12,18H,3,10,13-14H2,1-2H3 |
| InChIKey | XVKDERNYHAVCOW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|