C23H22FNO2S — CID 138662978
ethyl 2-[3-[1-(1-benzothiophen-3-yl)ethyl]-5-fluoro-2-methylindol-1-yl]acetate (PubChem CID 138662978) has the molecular formula C23H22FNO2S and a molecular weight of 395.50 g/mol. Its IUPAC name is ethyl 2-[3-[1-(1-benzothiophen-3-yl)ethyl]-5-fluoro-2-methylindol-1-yl]acetate.
| Compound Name | ethyl 2-[3-[1-(1-benzothiophen-3-yl)ethyl]-5-fluoro-2-methylindol-1-yl]acetate |
|---|---|
| PubChem CID | 138662978 |
| Molecular Formula | C23H22FNO2S |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | ethyl 2-[3-[1-(1-benzothiophen-3-yl)ethyl]-5-fluoro-2-methylindol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(C)c(C(C)c2csc3ccccc23)c2cc(F)ccc21 |
| InChI | InChI=1S/C23H22FNO2S/c1-4-27-22(26)12-25-15(3)23(18-11-16(24)9-10-20(18)25)14(2)19-13-28-21-8-6-5-7-17(19)21/h5-11,13-14H,4,12H2,1-3H3 |
| InChIKey | ZNFVKYMKDQLOGV-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|