C13H15ClFNO2S — CID 171248065
ethyl (3S)-3-amino-3-(1-benzothiophen-3-yl)-2-fluoropropanoate;hydrochloride (PubChem CID 171248065) has the molecular formula C13H15ClFNO2S and a molecular weight of 303.79 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(1-benzothiophen-3-yl)-2-fluoropropanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-3-(1-benzothiophen-3-yl)-2-fluoropropanoate;hydrochloride |
|---|---|
| PubChem CID | 171248065 |
| Molecular Formula | C13H15ClFNO2S |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | ethyl (3S)-3-amino-3-(1-benzothiophen-3-yl)-2-fluoropropanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)[C@@H](N)c1csc2ccccc12.Cl |
| InChI | InChI=1S/C13H14FNO2S.ClH/c1-2-17-13(16)11(14)12(15)9-7-18-10-6-4-3-5-8(9)10;/h3-7,11-12H,2,15H2,1H3;1H/t11?,12-;/m0./s1 |
| InChIKey | SQMDZGKYVTZCNY-MMFRDWCLSA-N |
| XLogP | 3.22 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |