C30H38FN2O4SSi — CID 69403690
CID 69403690 (PubChem CID 69403690) has the molecular formula C30H38FN2O4SSi and a molecular weight of 569.80 g/mol.
| Compound Name | CID 69403690 |
|---|---|
| PubChem CID | 69403690 |
| Molecular Formula | C30H38FN2O4SSi |
| Molecular Weight | 569.80 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | — |
| SMILES | CCOC(=O)Cn1c(C)c(C(c2ccc[nH]2)S(=O)(=O)c2ccccc2)c2cc(F)ccc21.CC[Si](CC)CC |
| InChI | InChI=1S/C24H23FN2O4S.C6H15Si/c1-3-31-22(28)15-27-16(2)23(19-14-17(25)11-12-21(19)27)24(20-10-7-13-26-20)32(29,30)18-8-5-4-6-9-18;1-4-7(5-2)6-3/h4-14,24,26H,3,15H2,1-2H3;4-6H2,1-3H3 |
| InChIKey | FSNFXYMWRMOBGS-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.80 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|