C31H37N5O5 — CID 66818762
ethyl 4-[3-[(4-aminocyclohexyl)carbamoyl]-5-[4-(3-aminopropanoylamino)phenoxy]phenoxy]benzenecarboximidate (PubChem CID 66818762) has the molecular formula C31H37N5O5 and a molecular weight of 559.67 g/mol. Its IUPAC name is ethyl 4-[3-[(4-aminocyclohexyl)carbamoyl]-5-[4-(3-aminopropanoylamino)phenoxy]phenoxy]benzenecarboximidate.
| Compound Name | ethyl 4-[3-[(4-aminocyclohexyl)carbamoyl]-5-[4-(3-aminopropanoylamino)phenoxy]phenoxy]benzenecarboximidate |
|---|---|
| PubChem CID | 66818762 |
| Molecular Formula | C31H37N5O5 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | ethyl 4-[3-[(4-aminocyclohexyl)carbamoyl]-5-[4-(3-aminopropanoylamino)phenoxy]phenoxy]benzenecarboximidate |
| SMILES | [H]/N=C(\OCC)c1ccc(Oc2cc(Oc3ccc(NC(=O)CCN)cc3)cc(C(=O)NC3CCC(N)CC3)c2)cc1 |
| InChI | InChI=1S/C31H37N5O5/c1-2-39-30(34)20-3-11-25(12-4-20)40-27-17-21(31(38)36-24-7-5-22(33)6-8-24)18-28(19-27)41-26-13-9-23(10-14-26)35-29(37)15-16-32/h3-4,9-14,17-19,22,24,34H,2,5-8,15-16,32-33H2,1H3,(H,35,37)(H,36,38)/b34-30- |
| InChIKey | BZDQABJGCBKWTH-BVNFUTIRSA-N |
| XLogP | 4.92 |
| TPSA | 161.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|