C33H40N4O5 — CID 66818243
ethyl 3-[[3-[(4-aminocyclohexyl)carbamoyl]-5-[[3-(C-ethoxycarbonimidoyl)phenyl]methoxy]phenoxy]methyl]benzenecarboximidate (PubChem CID 66818243) has the molecular formula C33H40N4O5 and a molecular weight of 572.71 g/mol. Its IUPAC name is ethyl 3-[[3-[(4-aminocyclohexyl)carbamoyl]-5-[[3-(C-ethoxycarbonimidoyl)phenyl]methoxy]phenoxy]methyl]benzenecarboximidate.
| Compound Name | ethyl 3-[[3-[(4-aminocyclohexyl)carbamoyl]-5-[[3-(C-ethoxycarbonimidoyl)phenyl]methoxy]phenoxy]methyl]benzenecarboximidate |
|---|---|
| PubChem CID | 66818243 |
| Molecular Formula | C33H40N4O5 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | ethyl 3-[[3-[(4-aminocyclohexyl)carbamoyl]-5-[[3-(C-ethoxycarbonimidoyl)phenyl]methoxy]phenoxy]methyl]benzenecarboximidate |
| SMILES | [H]/N=C(\OCC)c1cccc(COc2cc(OCc3cccc(/C(=N/[H])OCC)c3)cc(C(=O)NC3CCC(N)CC3)c2)c1 |
| InChI | InChI=1S/C33H40N4O5/c1-3-39-31(35)24-9-5-7-22(15-24)20-41-29-17-26(33(38)37-28-13-11-27(34)12-14-28)18-30(19-29)42-21-23-8-6-10-25(16-23)32(36)40-4-2/h5-10,15-19,27-28,35-36H,3-4,11-14,20-21,34H2,1-2H3,(H,37,38)/b35-31-,36-32- |
| InChIKey | GQVDOHLTZUCJQE-XGHKFRFXSA-N |
| XLogP | 5.57 |
| TPSA | 139.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|