C29H33N5O3 — CID 91252254
N-[3,5-bis[(3-carbamimidoylphenyl)methoxy]phenyl]cyclohexanecarboxamide (PubChem CID 91252254) has the molecular formula C29H33N5O3 and a molecular weight of 499.62 g/mol. Its IUPAC name is N-[3,5-bis[(3-carbamimidoylphenyl)methoxy]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[3,5-bis[(3-carbamimidoylphenyl)methoxy]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 91252254 |
| Molecular Formula | C29H33N5O3 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | N-[3,5-bis[(3-carbamimidoylphenyl)methoxy]phenyl]cyclohexanecarboxamide |
| SMILES | [H]/N=C(\N)c1cccc(COc2cc(NC(=O)C3CCCCC3)cc(OCc3cccc(/C(N)=N/[H])c3)c2)c1 |
| InChI | InChI=1S/C29H33N5O3/c30-27(31)22-10-4-6-19(12-22)17-36-25-14-24(34-29(35)21-8-2-1-3-9-21)15-26(16-25)37-18-20-7-5-11-23(13-20)28(32)33/h4-7,10-16,21H,1-3,8-9,17-18H2,(H3,30,31)(H3,32,33)(H,34,35) |
| InChIKey | RDDFSMLZQUALCA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 147.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|