C23H29N3O4 — CID 20534179
N-[2-[3-(carbamoylamino)-5-phenylmethoxyphenyl]-2-hydroxyethyl]cyclohexanecarboxamide (PubChem CID 20534179) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is N-[2-[3-(carbamoylamino)-5-phenylmethoxyphenyl]-2-hydroxyethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[3-(carbamoylamino)-5-phenylmethoxyphenyl]-2-hydroxyethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 20534179 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | N-[2-[3-(carbamoylamino)-5-phenylmethoxyphenyl]-2-hydroxyethyl]cyclohexanecarboxamide |
| SMILES | NC(=O)Nc1cc(OCc2ccccc2)cc(C(O)CNC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C23H29N3O4/c24-23(29)26-19-11-18(12-20(13-19)30-15-16-7-3-1-4-8-16)21(27)14-25-22(28)17-9-5-2-6-10-17/h1,3-4,7-8,11-13,17,21,27H,2,5-6,9-10,14-15H2,(H,25,28)(H3,24,26,29) |
| InChIKey | MFCQUULOLREHIW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |