C29H37N6O3+3 — CID 117072048
[amino-[3-[[3-[[3-[amino(azaniumylidene)methyl]phenyl]methoxy]-5-[(4-azaniumylcyclohexyl)carbamoyl]phenoxy]methyl]phenyl]methylidene]azanium (PubChem CID 117072048) has the molecular formula C29H37N6O3+3 and a molecular weight of 517.65 g/mol. Its IUPAC name is [amino-[3-[[3-[[3-[amino(azaniumylidene)methyl]phenyl]methoxy]-5-[(4-azaniumylcyclohexyl)carbamoyl]phenoxy]methyl]phenyl]methylidene]azanium.
| Compound Name | [amino-[3-[[3-[[3-[amino(azaniumylidene)methyl]phenyl]methoxy]-5-[(4-azaniumylcyclohexyl)carbamoyl]phenoxy]methyl]phenyl]methylidene]azanium |
|---|---|
| PubChem CID | 117072048 |
| Molecular Formula | C29H37N6O3+3 |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | [amino-[3-[[3-[[3-[amino(azaniumylidene)methyl]phenyl]methoxy]-5-[(4-azaniumylcyclohexyl)carbamoyl]phenoxy]methyl]phenyl]methylidene]azanium |
| SMILES | NC(=[NH2+])c1cccc(COc2cc(OCc3cccc(C(N)=[NH2+])c3)cc(C(=O)N[C@H]3CC[C@@H]([NH3+])CC3)c2)c1 |
| InChI | InChI=1S/C29H34N6O3/c30-23-7-9-24(10-8-23)35-29(36)22-13-25(37-16-18-3-1-5-20(11-18)27(31)32)15-26(14-22)38-17-19-4-2-6-21(12-19)28(33)34/h1-6,11-15,23-24H,7-10,16-17,30H2,(H3,31,32)(H3,33,34)(H,35,36)/p+3/t23-,24+ |
| InChIKey | UKPKEJBTCDGYRU-PSWAGMNNSA-Q |
| XLogP | -0.94 |
| TPSA | 178.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|