C34H42N4O5 — CID 66818346
ethyl 3-[[4-[4-(2-aminoethyl)piperidine-1-carbonyl]-3-[[3-(C-ethoxycarbonimidoyl)phenyl]methoxy]phenoxy]methyl]benzenecarboximidate (PubChem CID 66818346) has the molecular formula C34H42N4O5 and a molecular weight of 586.73 g/mol. Its IUPAC name is ethyl 3-[[4-[4-(2-aminoethyl)piperidine-1-carbonyl]-3-[[3-(C-ethoxycarbonimidoyl)phenyl]methoxy]phenoxy]methyl]benzenecarboximidate.
| Compound Name | ethyl 3-[[4-[4-(2-aminoethyl)piperidine-1-carbonyl]-3-[[3-(C-ethoxycarbonimidoyl)phenyl]methoxy]phenoxy]methyl]benzenecarboximidate |
|---|---|
| PubChem CID | 66818346 |
| Molecular Formula | C34H42N4O5 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.32 |
| IUPAC Name | ethyl 3-[[4-[4-(2-aminoethyl)piperidine-1-carbonyl]-3-[[3-(C-ethoxycarbonimidoyl)phenyl]methoxy]phenoxy]methyl]benzenecarboximidate |
| SMILES | [H]/N=C(\OCC)c1cccc(COc2ccc(C(=O)N3CCC(CCN)CC3)c(OCc3cccc(/C(=N/[H])OCC)c3)c2)c1 |
| InChI | InChI=1S/C34H42N4O5/c1-3-40-32(36)27-9-5-7-25(19-27)22-42-29-11-12-30(34(39)38-17-14-24(13-16-35)15-18-38)31(21-29)43-23-26-8-6-10-28(20-26)33(37)41-4-2/h5-12,19-21,24,36-37H,3-4,13-18,22-23,35H2,1-2H3/b36-32-,37-33- |
| InChIKey | KUHPFAZPWPOVQC-QAIJNKCPSA-N |
| XLogP | 5.77 |
| TPSA | 130.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|