C27H27N7O2 — CID 146459938
6-carbamimidoyl-1-[(4-carbamoylphenyl)methyl]-N-(6-pyrrolidin-1-yl-2-pyridinyl)indole-2-carboxamide (PubChem CID 146459938) has the molecular formula C27H27N7O2 and a molecular weight of 481.56 g/mol. Its IUPAC name is 6-carbamimidoyl-1-[(4-carbamoylphenyl)methyl]-N-(6-pyrrolidin-1-yl-2-pyridinyl)indole-2-carboxamide.
| Compound Name | 6-carbamimidoyl-1-[(4-carbamoylphenyl)methyl]-N-(6-pyrrolidin-1-yl-2-pyridinyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 146459938 |
| Molecular Formula | C27H27N7O2 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 6-carbamimidoyl-1-[(4-carbamoylphenyl)methyl]-N-(6-pyrrolidin-1-yl-2-pyridinyl)indole-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(C(=O)Nc3cccc(N4CCCC4)n3)n(Cc3ccc(C(N)=O)cc3)c2c1 |
| InChI | InChI=1S/C27H27N7O2/c28-25(29)20-11-10-19-14-22(27(36)32-23-4-3-5-24(31-23)33-12-1-2-13-33)34(21(19)15-20)16-17-6-8-18(9-7-17)26(30)35/h3-11,14-15H,1-2,12-13,16H2,(H3,28,29)(H2,30,35)(H,31,32,36) |
| InChIKey | IAZBPGJNAXDYHZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 143.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|