C18H15ClN4O3 — CID 146459830
6-carbamimidoyl-1-[(4-carbamoylphenyl)methyl]-3-chloroindole-2-carboxylic acid (PubChem CID 146459830) has the molecular formula C18H15ClN4O3 and a molecular weight of 370.80 g/mol. Its IUPAC name is 6-carbamimidoyl-1-[(4-carbamoylphenyl)methyl]-3-chloroindole-2-carboxylic acid.
| Compound Name | 6-carbamimidoyl-1-[(4-carbamoylphenyl)methyl]-3-chloroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 146459830 |
| Molecular Formula | C18H15ClN4O3 |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 6-carbamimidoyl-1-[(4-carbamoylphenyl)methyl]-3-chloroindole-2-carboxylic acid |
| SMILES | [H]/N=C(\N)c1ccc2c(Cl)c(C(=O)O)n(Cc3ccc(C(N)=O)cc3)c2c1 |
| InChI | InChI=1S/C18H15ClN4O3/c19-14-12-6-5-11(16(20)21)7-13(12)23(15(14)18(25)26)8-9-1-3-10(4-2-9)17(22)24/h1-7H,8H2,(H3,20,21)(H2,22,24)(H,25,26) |
| InChIKey | UZANEUIDBSNYTB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 135.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.80 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|