C31H26N4O3 — CID 11641874
2-[3-[(1-benzyl-6-carbamimidoylindol-3-yl)methyl]phenyl]-5-carbamoylbenzoic acid (PubChem CID 11641874) has the molecular formula C31H26N4O3 and a molecular weight of 502.57 g/mol. Its IUPAC name is 2-[3-[(1-benzyl-6-carbamimidoylindol-3-yl)methyl]phenyl]-5-carbamoylbenzoic acid.
| Compound Name | 2-[3-[(1-benzyl-6-carbamimidoylindol-3-yl)methyl]phenyl]-5-carbamoylbenzoic acid |
|---|---|
| PubChem CID | 11641874 |
| Molecular Formula | C31H26N4O3 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 2-[3-[(1-benzyl-6-carbamimidoylindol-3-yl)methyl]phenyl]-5-carbamoylbenzoic acid |
| SMILES | [H]/N=C(\N)c1ccc2c(Cc3cccc(-c4ccc(C(N)=O)cc4C(=O)O)c3)cn(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C31H26N4O3/c32-29(33)22-9-12-26-24(18-35(28(26)16-22)17-19-5-2-1-3-6-19)14-20-7-4-8-21(13-20)25-11-10-23(30(34)36)15-27(25)31(37)38/h1-13,15-16,18H,14,17H2,(H3,32,33)(H2,34,36)(H,37,38) |
| InChIKey | CESTZBOAYQBOJC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 135.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|