C30H32N4O3 — CID 11533346
2-[2-[(6-carbamimidoyl-1-ethylindol-3-yl)methyl]-5-(propylcarbamoyl)phenyl]-5-methylbenzoic acid (PubChem CID 11533346) has the molecular formula C30H32N4O3 and a molecular weight of 496.61 g/mol. Its IUPAC name is 2-[2-[(6-carbamimidoyl-1-ethylindol-3-yl)methyl]-5-(propylcarbamoyl)phenyl]-5-methylbenzoic acid.
| Compound Name | 2-[2-[(6-carbamimidoyl-1-ethylindol-3-yl)methyl]-5-(propylcarbamoyl)phenyl]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 11533346 |
| Molecular Formula | C30H32N4O3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 2-[2-[(6-carbamimidoyl-1-ethylindol-3-yl)methyl]-5-(propylcarbamoyl)phenyl]-5-methylbenzoic acid |
| SMILES | [H]/N=C(\N)c1ccc2c(Cc3ccc(C(=O)NCCC)cc3-c3ccc(C)cc3C(=O)O)cn(CC)c2c1 |
| InChI | InChI=1S/C30H32N4O3/c1-4-12-33-29(35)21-8-7-19(25(15-21)24-10-6-18(3)13-26(24)30(36)37)14-22-17-34(5-2)27-16-20(28(31)32)9-11-23(22)27/h6-11,13,15-17H,4-5,12,14H2,1-3H3,(H3,31,32)(H,33,35)(H,36,37) |
| InChIKey | RDCQLPXNMCKECV-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 121.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|