C28H28N4O4 — CID 11591174
2-[2-[[1-(3-amino-2-methyl-3-oxopropyl)-6-carbamimidoylindol-3-yl]methyl]phenyl]-5-methoxybenzoic acid (PubChem CID 11591174) has the molecular formula C28H28N4O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is 2-[2-[[1-(3-amino-2-methyl-3-oxopropyl)-6-carbamimidoylindol-3-yl]methyl]phenyl]-5-methoxybenzoic acid.
| Compound Name | 2-[2-[[1-(3-amino-2-methyl-3-oxopropyl)-6-carbamimidoylindol-3-yl]methyl]phenyl]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 11591174 |
| Molecular Formula | C28H28N4O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 2-[2-[[1-(3-amino-2-methyl-3-oxopropyl)-6-carbamimidoylindol-3-yl]methyl]phenyl]-5-methoxybenzoic acid |
| SMILES | [H]/N=C(\N)c1ccc2c(Cc3ccccc3-c3ccc(OC)cc3C(=O)O)cn(CC(C)C(N)=O)c2c1 |
| InChI | InChI=1S/C28H28N4O4/c1-16(27(31)33)14-32-15-19(22-9-7-18(26(29)30)12-25(22)32)11-17-5-3-4-6-21(17)23-10-8-20(36-2)13-24(23)28(34)35/h3-10,12-13,15-16H,11,14H2,1-2H3,(H3,29,30)(H2,31,33)(H,34,35) |
| InChIKey | ZARSZIPHFFVPKT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 144.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|