C23H23N5O2 — CID 11553130
4-[2-[(6-carbamimidoyl-1-ethylindol-3-yl)methyl]phenyl]-1-methylpyrazole-3-carboxylic acid (PubChem CID 11553130) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 4-[2-[(6-carbamimidoyl-1-ethylindol-3-yl)methyl]phenyl]-1-methylpyrazole-3-carboxylic acid.
| Compound Name | 4-[2-[(6-carbamimidoyl-1-ethylindol-3-yl)methyl]phenyl]-1-methylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 11553130 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 4-[2-[(6-carbamimidoyl-1-ethylindol-3-yl)methyl]phenyl]-1-methylpyrazole-3-carboxylic acid |
| SMILES | [H]/N=C(\N)c1ccc2c(Cc3ccccc3-c3cn(C)nc3C(=O)O)cn(CC)c2c1 |
| InChI | InChI=1S/C23H23N5O2/c1-3-28-12-16(18-9-8-15(22(24)25)11-20(18)28)10-14-6-4-5-7-17(14)19-13-27(2)26-21(19)23(29)30/h4-9,11-13H,3,10H2,1-2H3,(H3,24,25)(H,29,30) |
| InChIKey | YNLTVLPTCLOMSK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 109.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|