C30H32N4O4 — CID 11584348
2-[2-[(6-carbamimidoyl-1-ethylindol-3-yl)methyl]-5-(propylcarbamoyl)phenyl]-5-methoxybenzoic acid (PubChem CID 11584348) has the molecular formula C30H32N4O4 and a molecular weight of 512.61 g/mol. Its IUPAC name is 2-[2-[(6-carbamimidoyl-1-ethylindol-3-yl)methyl]-5-(propylcarbamoyl)phenyl]-5-methoxybenzoic acid.
| Compound Name | 2-[2-[(6-carbamimidoyl-1-ethylindol-3-yl)methyl]-5-(propylcarbamoyl)phenyl]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 11584348 |
| Molecular Formula | C30H32N4O4 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | 2-[2-[(6-carbamimidoyl-1-ethylindol-3-yl)methyl]-5-(propylcarbamoyl)phenyl]-5-methoxybenzoic acid |
| SMILES | [H]/N=C(\N)c1ccc2c(Cc3ccc(C(=O)NCCC)cc3-c3ccc(OC)cc3C(=O)O)cn(CC)c2c1 |
| InChI | InChI=1S/C30H32N4O4/c1-4-12-33-29(35)20-7-6-18(25(14-20)24-11-9-22(38-3)16-26(24)30(36)37)13-21-17-34(5-2)27-15-19(28(31)32)8-10-23(21)27/h6-11,14-17H,4-5,12-13H2,1-3H3,(H3,31,32)(H,33,35)(H,36,37) |
| InChIKey | APDODYDFXHLJRS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 130.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|