C33H32N6O4 — CID 11505165
2-[2-[[1-ethyl-6-[(E)-N'-hydroxycarbamimidoyl]indol-3-yl]methyl]-5-[(5-methylpyrazin-2-yl)methylcarbamoyl]phenyl]-5-methylbenzoic acid (PubChem CID 11505165) has the molecular formula C33H32N6O4 and a molecular weight of 576.66 g/mol. Its IUPAC name is 2-[2-[[1-ethyl-6-[(E)-N'-hydroxycarbamimidoyl]indol-3-yl]methyl]-5-[(5-methylpyrazin-2-yl)methylcarbamoyl]phenyl]-5-methylbenzoic acid.
| Compound Name | 2-[2-[[1-ethyl-6-[(E)-N'-hydroxycarbamimidoyl]indol-3-yl]methyl]-5-[(5-methylpyrazin-2-yl)methylcarbamoyl]phenyl]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 11505165 |
| Molecular Formula | C33H32N6O4 |
| Molecular Weight | 576.66 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | 2-[2-[[1-ethyl-6-[(E)-N'-hydroxycarbamimidoyl]indol-3-yl]methyl]-5-[(5-methylpyrazin-2-yl)methylcarbamoyl]phenyl]-5-methylbenzoic acid |
| SMILES | CCn1cc(Cc2ccc(C(=O)NCc3cnc(C)cn3)cc2-c2ccc(C)cc2C(=O)O)c2ccc(/C(N)=N\O)cc21 |
| InChI | InChI=1S/C33H32N6O4/c1-4-39-18-24(26-10-8-22(14-30(26)39)31(34)38-43)12-21-6-7-23(32(40)37-17-25-16-35-20(3)15-36-25)13-28(21)27-9-5-19(2)11-29(27)33(41)42/h5-11,13-16,18,43H,4,12,17H2,1-3H3,(H2,34,38)(H,37,40)(H,41,42) |
| InChIKey | ZNZDCWMWZFARKJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 155.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.66 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|