C32H31N3O3 — CID 11454939
2-[2-[(3-benzyl-5-carbamimidoyl-2,3-dihydroindol-1-yl)methyl]-4-methylphenyl]-5-methoxybenzoic acid (PubChem CID 11454939) has the molecular formula C32H31N3O3 and a molecular weight of 505.62 g/mol. Its IUPAC name is 2-[2-[(3-benzyl-5-carbamimidoyl-2,3-dihydroindol-1-yl)methyl]-4-methylphenyl]-5-methoxybenzoic acid.
| Compound Name | 2-[2-[(3-benzyl-5-carbamimidoyl-2,3-dihydroindol-1-yl)methyl]-4-methylphenyl]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 11454939 |
| Molecular Formula | C32H31N3O3 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 2-[2-[(3-benzyl-5-carbamimidoyl-2,3-dihydroindol-1-yl)methyl]-4-methylphenyl]-5-methoxybenzoic acid |
| SMILES | [H]/N=C(\N)c1ccc2c(c1)C(Cc1ccccc1)CN2Cc1cc(C)ccc1-c1ccc(OC)cc1C(=O)O |
| InChI | InChI=1S/C32H31N3O3/c1-20-8-11-26(27-12-10-25(38-2)17-29(27)32(36)37)23(14-20)18-35-19-24(15-21-6-4-3-5-7-21)28-16-22(31(33)34)9-13-30(28)35/h3-14,16-17,24H,15,18-19H2,1-2H3,(H3,33,34)(H,36,37) |
| InChIKey | YDHWQKPQSDIQSB-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|