C29H30ClN5O4 — CID 70094225
2-[4-benzyl-2-[(4-methoxyphenyl)methyl]-3,6-dioxopiperazin-1-yl]-N-[(4-carbamimidoyl-2-chlorophenyl)methyl]acetamide (PubChem CID 70094225) has the molecular formula C29H30ClN5O4 and a molecular weight of 548.04 g/mol. Its IUPAC name is 2-[4-benzyl-2-[(4-methoxyphenyl)methyl]-3,6-dioxopiperazin-1-yl]-N-[(4-carbamimidoyl-2-chlorophenyl)methyl]acetamide.
| Compound Name | 2-[4-benzyl-2-[(4-methoxyphenyl)methyl]-3,6-dioxopiperazin-1-yl]-N-[(4-carbamimidoyl-2-chlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 70094225 |
| Molecular Formula | C29H30ClN5O4 |
| Molecular Weight | 548.04 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | 2-[4-benzyl-2-[(4-methoxyphenyl)methyl]-3,6-dioxopiperazin-1-yl]-N-[(4-carbamimidoyl-2-chlorophenyl)methyl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)CN2C(=O)CN(Cc3ccccc3)C(=O)C2Cc2ccc(OC)cc2)c(Cl)c1 |
| InChI | InChI=1S/C29H30ClN5O4/c1-39-23-11-7-19(8-12-23)13-25-29(38)34(16-20-5-3-2-4-6-20)18-27(37)35(25)17-26(36)33-15-22-10-9-21(28(31)32)14-24(22)30/h2-12,14,25H,13,15-18H2,1H3,(H3,31,32)(H,33,36) |
| InChIKey | BMXDGNLUMCADLL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 128.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.04 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|