C28H30N4O4 — CID 142628845
4-[[(4S)-1-benzyl-3-[(2,4-dimethoxy-3-methylphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]methyl]benzenecarboximidamide (PubChem CID 142628845) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is 4-[[(4S)-1-benzyl-3-[(2,4-dimethoxy-3-methylphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]methyl]benzenecarboximidamide.
| Compound Name | 4-[[(4S)-1-benzyl-3-[(2,4-dimethoxy-3-methylphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 142628845 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 4-[[(4S)-1-benzyl-3-[(2,4-dimethoxy-3-methylphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C[C@H]2C(=O)N(Cc3ccccc3)C(=O)N2Cc2ccc(OC)c(C)c2OC)cc1 |
| InChI | InChI=1S/C28H30N4O4/c1-18-24(35-2)14-13-22(25(18)36-3)17-31-23(15-19-9-11-21(12-10-19)26(29)30)27(33)32(28(31)34)16-20-7-5-4-6-8-20/h4-14,23H,15-17H2,1-3H3,(H3,29,30)/t23-/m0/s1 |
| InChIKey | KASCCTVBMVQWCN-QHCPKHFHSA-N |
| XLogP | 3.87 |
| TPSA | 108.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|