C37H46N2O9 — CID 102575850
propan-2-yl (2S,5Z)-4-benzyl-3-oxo-2-[(2,4,5-trimethoxy-3-methylphenyl)methyl]-5-[(2,4,5-trimethoxy-3-methylphenyl)methylidene]piperazine-1-carboxylate (PubChem CID 102575850) has the molecular formula C37H46N2O9 and a molecular weight of 662.78 g/mol. Its IUPAC name is propan-2-yl (2S,5Z)-4-benzyl-3-oxo-2-[(2,4,5-trimethoxy-3-methylphenyl)methyl]-5-[(2,4,5-trimethoxy-3-methylphenyl)methylidene]piperazine-1-carboxylate.
| Compound Name | propan-2-yl (2S,5Z)-4-benzyl-3-oxo-2-[(2,4,5-trimethoxy-3-methylphenyl)methyl]-5-[(2,4,5-trimethoxy-3-methylphenyl)methylidene]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 102575850 |
| Molecular Formula | C37H46N2O9 |
| Molecular Weight | 662.78 g/mol |
| Exact Mass | 662.32 |
| IUPAC Name | propan-2-yl (2S,5Z)-4-benzyl-3-oxo-2-[(2,4,5-trimethoxy-3-methylphenyl)methyl]-5-[(2,4,5-trimethoxy-3-methylphenyl)methylidene]piperazine-1-carboxylate |
| SMILES | COc1cc(/C=C2/CN(C(=O)OC(C)C)[C@@H](Cc3cc(OC)c(OC)c(C)c3OC)C(=O)N2Cc2ccccc2)c(OC)c(C)c1OC |
| InChI | InChI=1S/C37H46N2O9/c1-22(2)48-37(41)39-21-28(16-26-18-30(42-5)34(46-9)23(3)32(26)44-7)38(20-25-14-12-11-13-15-25)36(40)29(39)17-27-19-31(43-6)35(47-10)24(4)33(27)45-8/h11-16,18-19,22,29H,17,20-21H2,1-10H3/b28-16-/t29-/m0/s1 |
| InChIKey | DNIQWIVDIWQDKH-KXXVVDRPSA-N |
| XLogP | 6.20 |
| TPSA | 105.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.78 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |