C30H40N2O9 — CID 102575849
propan-2-yl (2S,5Z)-3-oxo-2-[(2,4,5-trimethoxy-3-methylphenyl)methyl]-5-[(2,4,5-trimethoxy-3-methylphenyl)methylidene]piperazine-1-carboxylate (PubChem CID 102575849) has the molecular formula C30H40N2O9 and a molecular weight of 572.66 g/mol. Its IUPAC name is propan-2-yl (2S,5Z)-3-oxo-2-[(2,4,5-trimethoxy-3-methylphenyl)methyl]-5-[(2,4,5-trimethoxy-3-methylphenyl)methylidene]piperazine-1-carboxylate.
| Compound Name | propan-2-yl (2S,5Z)-3-oxo-2-[(2,4,5-trimethoxy-3-methylphenyl)methyl]-5-[(2,4,5-trimethoxy-3-methylphenyl)methylidene]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 102575849 |
| Molecular Formula | C30H40N2O9 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | propan-2-yl (2S,5Z)-3-oxo-2-[(2,4,5-trimethoxy-3-methylphenyl)methyl]-5-[(2,4,5-trimethoxy-3-methylphenyl)methylidene]piperazine-1-carboxylate |
| SMILES | COc1cc(/C=C2/CN(C(=O)OC(C)C)[C@@H](Cc3cc(OC)c(OC)c(C)c3OC)C(=O)N2)c(OC)c(C)c1OC |
| InChI | InChI=1S/C30H40N2O9/c1-16(2)41-30(34)32-15-21(11-19-13-23(35-5)27(39-9)17(3)25(19)37-7)31-29(33)22(32)12-20-14-24(36-6)28(40-10)18(4)26(20)38-8/h11,13-14,16,22H,12,15H2,1-10H3,(H,31,33)/b21-11-/t22-/m0/s1 |
| InChIKey | JLPVLWAJWGCRFA-PBDXZUMESA-N |
| XLogP | 4.28 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |