C30H36N2O10 — CID 53247912
ethyl (3Z,6S,11aS)-7,8,10-trimethoxy-9-methyl-1,4-dioxo-3-[(2,4,5-trimethoxy-3-methylphenyl)methylidene]-11,11a-dihydro-6H-pyrazino[1,2-b]isoquinoline-6-carboxylate (PubChem CID 53247912) has the molecular formula C30H36N2O10 and a molecular weight of 584.62 g/mol. Its IUPAC name is ethyl (3Z,6S,11aS)-7,8,10-trimethoxy-9-methyl-1,4-dioxo-3-[(2,4,5-trimethoxy-3-methylphenyl)methylidene]-11,11a-dihydro-6H-pyrazino[1,2-b]isoquinoline-6-carboxylate.
| Compound Name | ethyl (3Z,6S,11aS)-7,8,10-trimethoxy-9-methyl-1,4-dioxo-3-[(2,4,5-trimethoxy-3-methylphenyl)methylidene]-11,11a-dihydro-6H-pyrazino[1,2-b]isoquinoline-6-carboxylate |
|---|---|
| PubChem CID | 53247912 |
| Molecular Formula | C30H36N2O10 |
| Molecular Weight | 584.62 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | ethyl (3Z,6S,11aS)-7,8,10-trimethoxy-9-methyl-1,4-dioxo-3-[(2,4,5-trimethoxy-3-methylphenyl)methylidene]-11,11a-dihydro-6H-pyrazino[1,2-b]isoquinoline-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1c2c(c(OC)c(C)c(OC)c2OC)C[C@H]2C(=O)N/C(=C\c3cc(OC)c(OC)c(C)c3OC)C(=O)N12 |
| InChI | InChI=1S/C30H36N2O10/c1-10-42-30(35)22-21-17(24(38-6)15(3)26(40-8)27(21)41-9)13-19-28(33)31-18(29(34)32(19)22)11-16-12-20(36-4)25(39-7)14(2)23(16)37-5/h11-12,19,22H,10,13H2,1-9H3,(H,31,33)/b18-11-/t19-,22-/m0/s1 |
| InChIKey | UNSYCVKOWSCAHF-HRVCPSLJSA-N |
| XLogP | 2.88 |
| TPSA | 131.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.62 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|