C17H22N2O5 — CID 10854159
(3Z,6S)-1,6-dimethyl-3-[(2,4,5-trimethoxy-3-methylphenyl)methylidene]piperazine-2,5-dione (PubChem CID 10854159) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is (3Z,6S)-1,6-dimethyl-3-[(2,4,5-trimethoxy-3-methylphenyl)methylidene]piperazine-2,5-dione.
| Compound Name | (3Z,6S)-1,6-dimethyl-3-[(2,4,5-trimethoxy-3-methylphenyl)methylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 10854159 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (3Z,6S)-1,6-dimethyl-3-[(2,4,5-trimethoxy-3-methylphenyl)methylidene]piperazine-2,5-dione |
| SMILES | COc1cc(/C=C2\NC(=O)[C@H](C)N(C)C2=O)c(OC)c(C)c1OC |
| InChI | InChI=1S/C17H22N2O5/c1-9-14(23-5)11(8-13(22-4)15(9)24-6)7-12-17(21)19(3)10(2)16(20)18-12/h7-8,10H,1-6H3,(H,18,20)/b12-7-/t10-/m0/s1 |
| InChIKey | VIIZHXARTFTHAO-BZPKPHBRSA-N |
| XLogP | 1.34 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|