C13H13ClN2O3S — CID 839833
5-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-3-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 839833) has the molecular formula C13H13ClN2O3S and a molecular weight of 312.78 g/mol. Its IUPAC name is 5-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-3-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-3-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 839833 |
| Molecular Formula | C13H13ClN2O3S |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 5-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-3-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1cc(Cl)c(C=C2NC(=S)N(C)C2=O)cc1OC |
| InChI | InChI=1S/C13H13ClN2O3S/c1-16-12(17)9(15-13(16)20)4-7-5-10(18-2)11(19-3)6-8(7)14/h4-6H,1-3H3,(H,15,20) |
| InChIKey | RFYYPMYETFCXKK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|