C17H24N2O6 — CID 10360649
ethyl 4-(3,4,5-trimethoxybenzoyl)piperazine-2-carboxylate (PubChem CID 10360649) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is ethyl 4-(3,4,5-trimethoxybenzoyl)piperazine-2-carboxylate.
| Compound Name | ethyl 4-(3,4,5-trimethoxybenzoyl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 10360649 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | ethyl 4-(3,4,5-trimethoxybenzoyl)piperazine-2-carboxylate |
| SMILES | CCOC(=O)C1CN(C(=O)c2cc(OC)c(OC)c(OC)c2)CCN1 |
| InChI | InChI=1S/C17H24N2O6/c1-5-25-17(21)12-10-19(7-6-18-12)16(20)11-8-13(22-2)15(24-4)14(9-11)23-3/h8-9,12,18H,5-7,10H2,1-4H3 |
| InChIKey | HNJPWMXAMFPRFM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |