C15H20N2O5 — CID 110727928
1-(3,4,5-trimethoxybenzoyl)-1,4-diazepan-5-one (PubChem CID 110727928) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is 1-(3,4,5-trimethoxybenzoyl)-1,4-diazepan-5-one.
| Compound Name | 1-(3,4,5-trimethoxybenzoyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 110727928 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 1-(3,4,5-trimethoxybenzoyl)-1,4-diazepan-5-one |
| SMILES | COc1cc(C(=O)N2CCNC(=O)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C15H20N2O5/c1-20-11-8-10(9-12(21-2)14(11)22-3)15(19)17-6-4-13(18)16-5-7-17/h8-9H,4-7H2,1-3H3,(H,16,18) |
| InChIKey | YEGMVHRARYWNOB-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |