C22H21N3O7 — CID 16632826
ethyl 4-[[2-[(4Z)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate (PubChem CID 16632826) has the molecular formula C22H21N3O7 and a molecular weight of 439.42 g/mol. Its IUPAC name is ethyl 4-[[2-[(4Z)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(4Z)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 16632826 |
| Molecular Formula | C22H21N3O7 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | ethyl 4-[[2-[(4Z)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN2C(=O)N/C(=C\c3ccc(O)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C22H21N3O7/c1-3-32-21(29)14-5-7-15(8-6-14)23-19(27)12-25-20(28)16(24-22(25)30)10-13-4-9-17(26)18(11-13)31-2/h4-11,26H,3,12H2,1-2H3,(H,23,27)(H,24,30)/b16-10- |
| InChIKey | PPLSXKZHRWYALW-YBEGLDIGSA-N |
| XLogP | 2.11 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|