C25H29N5O3 — CID 146460064
6-carbamimidoyl-1-[(4-carbamoylphenyl)methyl]-N-(cyclohexylmethyl)-3-hydroxyindole-2-carboxamide (PubChem CID 146460064) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is 6-carbamimidoyl-1-[(4-carbamoylphenyl)methyl]-N-(cyclohexylmethyl)-3-hydroxyindole-2-carboxamide.
| Compound Name | 6-carbamimidoyl-1-[(4-carbamoylphenyl)methyl]-N-(cyclohexylmethyl)-3-hydroxyindole-2-carboxamide |
|---|---|
| PubChem CID | 146460064 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 6-carbamimidoyl-1-[(4-carbamoylphenyl)methyl]-N-(cyclohexylmethyl)-3-hydroxyindole-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc2c(O)c(C(=O)NCC3CCCCC3)n(Cc3ccc(C(N)=O)cc3)c2c1 |
| InChI | InChI=1S/C25H29N5O3/c26-23(27)18-10-11-19-20(12-18)30(14-16-6-8-17(9-7-16)24(28)32)21(22(19)31)25(33)29-13-15-4-2-1-3-5-15/h6-12,15,31H,1-5,13-14H2,(H3,26,27)(H2,28,32)(H,29,33) |
| InChIKey | ARQUPZOARBGSMM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 147.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|