C29H25N5O — CID 11037866
1-[(3-carbamimidoylphenyl)methyl]-N-[phenyl(pyridin-4-yl)methyl]indole-2-carboxamide (PubChem CID 11037866) has the molecular formula C29H25N5O and a molecular weight of 459.55 g/mol. Its IUPAC name is 1-[(3-carbamimidoylphenyl)methyl]-N-[phenyl(pyridin-4-yl)methyl]indole-2-carboxamide.
| Compound Name | 1-[(3-carbamimidoylphenyl)methyl]-N-[phenyl(pyridin-4-yl)methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 11037866 |
| Molecular Formula | C29H25N5O |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 1-[(3-carbamimidoylphenyl)methyl]-N-[phenyl(pyridin-4-yl)methyl]indole-2-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(Cn2c(C(=O)NC(c3ccccc3)c3ccncc3)cc3ccccc32)c1 |
| InChI | InChI=1S/C29H25N5O/c30-28(31)24-11-6-7-20(17-24)19-34-25-12-5-4-10-23(25)18-26(34)29(35)33-27(21-8-2-1-3-9-21)22-13-15-32-16-14-22/h1-18,27H,19H2,(H3,30,31)(H,33,35) |
| InChIKey | NTDHKQLMPDAVDU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|