C24H22N4OS — CID 18327585
1-[(3-carbamothioylphenyl)methyl]-N-(2-pyridin-4-ylethyl)indole-2-carboxamide (PubChem CID 18327585) has the molecular formula C24H22N4OS and a molecular weight of 414.53 g/mol. Its IUPAC name is 1-[(3-carbamothioylphenyl)methyl]-N-(2-pyridin-4-ylethyl)indole-2-carboxamide.
| Compound Name | 1-[(3-carbamothioylphenyl)methyl]-N-(2-pyridin-4-ylethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 18327585 |
| Molecular Formula | C24H22N4OS |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 1-[(3-carbamothioylphenyl)methyl]-N-(2-pyridin-4-ylethyl)indole-2-carboxamide |
| SMILES | NC(=S)c1cccc(Cn2c(C(=O)NCCc3ccncc3)cc3ccccc32)c1 |
| InChI | InChI=1S/C24H22N4OS/c25-23(30)20-6-3-4-18(14-20)16-28-21-7-2-1-5-19(21)15-22(28)24(29)27-13-10-17-8-11-26-12-9-17/h1-9,11-12,14-15H,10,13,16H2,(H2,25,30)(H,27,29) |
| InChIKey | BNQISZWNVZNSPF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|