C25H22N4O3S — CID 18327588
methyl 1-[(3-carbamothioylphenyl)methyl]-2-(pyridin-4-ylmethylcarbamoyl)indole-3-carboxylate (PubChem CID 18327588) has the molecular formula C25H22N4O3S and a molecular weight of 458.54 g/mol. Its IUPAC name is methyl 1-[(3-carbamothioylphenyl)methyl]-2-(pyridin-4-ylmethylcarbamoyl)indole-3-carboxylate.
| Compound Name | methyl 1-[(3-carbamothioylphenyl)methyl]-2-(pyridin-4-ylmethylcarbamoyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 18327588 |
| Molecular Formula | C25H22N4O3S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | methyl 1-[(3-carbamothioylphenyl)methyl]-2-(pyridin-4-ylmethylcarbamoyl)indole-3-carboxylate |
| SMILES | COC(=O)c1c(C(=O)NCc2ccncc2)n(Cc2cccc(C(N)=S)c2)c2ccccc12 |
| InChI | InChI=1S/C25H22N4O3S/c1-32-25(31)21-19-7-2-3-8-20(19)29(15-17-5-4-6-18(13-17)23(26)33)22(21)24(30)28-14-16-9-11-27-12-10-16/h2-13H,14-15H2,1H3,(H2,26,33)(H,28,30) |
| InChIKey | SQTCPQUBBOUMQD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|