C33H34Cl2FN5O — CID 18327596
benzyl-[4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-fluoroindole-2-carbonyl]amino]methyl]phenyl]-dimethylazanium;chloride;hydrochloride (PubChem CID 18327596) has the molecular formula C33H34Cl2FN5O and a molecular weight of 606.57 g/mol. Its IUPAC name is benzyl-[4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-fluoroindole-2-carbonyl]amino]methyl]phenyl]-dimethylazanium;chloride;hydrochloride.
| Compound Name | benzyl-[4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-fluoroindole-2-carbonyl]amino]methyl]phenyl]-dimethylazanium;chloride;hydrochloride |
|---|---|
| PubChem CID | 18327596 |
| Molecular Formula | C33H34Cl2FN5O |
| Molecular Weight | 606.57 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | benzyl-[4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-fluoroindole-2-carbonyl]amino]methyl]phenyl]-dimethylazanium;chloride;hydrochloride |
| SMILES | Cl.[Cl-].[H]/N=C(\N)c1cccc(Cn2c(C(=O)NCc3ccc([N+](C)(C)Cc4ccccc4)cc3)cc3cc(F)ccc32)c1 |
| InChI | InChI=1S/C33H32FN5O.2ClH/c1-39(2,22-24-7-4-3-5-8-24)29-14-11-23(12-15-29)20-37-33(40)31-19-27-18-28(34)13-16-30(27)38(31)21-25-9-6-10-26(17-25)32(35)36;;/h3-19H,20-22H2,1-2H3,(H3-,35,36,37,40);2*1H |
| InChIKey | SPHAROZJZSMLSP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.57 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|