C23H23ClN2O — CID 68551759
4-chloro-3-naphthalen-2-yl-N-(piperidin-4-ylmethyl)benzamide (PubChem CID 68551759) has the molecular formula C23H23ClN2O and a molecular weight of 378.90 g/mol. Its IUPAC name is 4-chloro-3-naphthalen-2-yl-N-(piperidin-4-ylmethyl)benzamide.
| Compound Name | 4-chloro-3-naphthalen-2-yl-N-(piperidin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 68551759 |
| Molecular Formula | C23H23ClN2O |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 4-chloro-3-naphthalen-2-yl-N-(piperidin-4-ylmethyl)benzamide |
| SMILES | O=C(NCC1CCNCC1)c1ccc(Cl)c(-c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C23H23ClN2O/c24-22-8-7-20(23(27)26-15-16-9-11-25-12-10-16)14-21(22)19-6-5-17-3-1-2-4-18(17)13-19/h1-8,13-14,16,25H,9-12,15H2,(H,26,27) |
| InChIKey | OVMJVLVQQVHVDE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |